C16H15F3N2 — CID 132545724
phenyl-(4,4,4-trifluoro-1-phenylbutan-2-yl)diazene (PubChem CID 132545724) has the molecular formula C16H15F3N2 and a molecular weight of 292.30 g/mol. Its IUPAC name is phenyl-(4,4,4-trifluoro-1-phenylbutan-2-yl)diazene.
| Compound Name | phenyl-(4,4,4-trifluoro-1-phenylbutan-2-yl)diazene |
|---|---|
| PubChem CID | 132545724 |
| Molecular Formula | C16H15F3N2 |
| Molecular Weight | 292.30 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | phenyl-(4,4,4-trifluoro-1-phenylbutan-2-yl)diazene |
| SMILES | FC(F)(F)CC(Cc1ccccc1)/N=N/c1ccccc1 |
| InChI | InChI=1S/C16H15F3N2/c17-16(18,19)12-15(11-13-7-3-1-4-8-13)21-20-14-9-5-2-6-10-14/h1-10,15H,11-12H2/b21-20+ |
| InChIKey | FQQLYIPJMJYMIQ-QZQOTICOSA-N |
| XLogP | 5.33 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.30 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|