C11H22F3N — CID 115892026
4-methyl-N-(4,4,4-trifluorobutan-2-yl)hexan-2-amine (PubChem CID 115892026) has the molecular formula C11H22F3N and a molecular weight of 225.30 g/mol. Its IUPAC name is 4-methyl-N-(4,4,4-trifluorobutan-2-yl)hexan-2-amine.
| Compound Name | 4-methyl-N-(4,4,4-trifluorobutan-2-yl)hexan-2-amine |
|---|---|
| PubChem CID | 115892026 |
| Molecular Formula | C11H22F3N |
| Molecular Weight | 225.30 g/mol |
| Exact Mass | 225.17 |
| IUPAC Name | 4-methyl-N-(4,4,4-trifluorobutan-2-yl)hexan-2-amine |
| SMILES | CCC(C)CC(C)NC(C)CC(F)(F)F |
| InChI | InChI=1S/C11H22F3N/c1-5-8(2)6-9(3)15-10(4)7-11(12,13)14/h8-10,15H,5-7H2,1-4H3 |
| InChIKey | OUJIEPDDZUVRMN-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.30 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |