C10H19F3N2 — CID 123295140
2,2,2-trifluoro-N'-methyl-N-(4-methylhexan-2-yl)ethanimidamide (PubChem CID 123295140) has the molecular formula C10H19F3N2 and a molecular weight of 224.27 g/mol. Its IUPAC name is 2,2,2-trifluoro-N'-methyl-N-(4-methylhexan-2-yl)ethanimidamide.
| Compound Name | 2,2,2-trifluoro-N'-methyl-N-(4-methylhexan-2-yl)ethanimidamide |
|---|---|
| PubChem CID | 123295140 |
| Molecular Formula | C10H19F3N2 |
| Molecular Weight | 224.27 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | 2,2,2-trifluoro-N'-methyl-N-(4-methylhexan-2-yl)ethanimidamide |
| SMILES | CCC(C)CC(C)N/C(=N\C)C(F)(F)F |
| InChI | InChI=1S/C10H19F3N2/c1-5-7(2)6-8(3)15-9(14-4)10(11,12)13/h7-8H,5-6H2,1-4H3,(H,14,15) |
| InChIKey | LBUUDSNNGYLAQN-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.27 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|