C12H24F3N — CID 104860331
5-methyl-N-(4,4,4-trifluorobutan-2-yl)heptan-3-amine (PubChem CID 104860331) has the molecular formula C12H24F3N and a molecular weight of 239.32 g/mol. Its IUPAC name is 5-methyl-N-(4,4,4-trifluorobutan-2-yl)heptan-3-amine.
| Compound Name | 5-methyl-N-(4,4,4-trifluorobutan-2-yl)heptan-3-amine |
|---|---|
| PubChem CID | 104860331 |
| Molecular Formula | C12H24F3N |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.19 |
| IUPAC Name | 5-methyl-N-(4,4,4-trifluorobutan-2-yl)heptan-3-amine |
| SMILES | CCC(C)CC(CC)NC(C)CC(F)(F)F |
| InChI | InChI=1S/C12H24F3N/c1-5-9(3)7-11(6-2)16-10(4)8-12(13,14)15/h9-11,16H,5-8H2,1-4H3 |
| InChIKey | PCWTVKHRNNRYQQ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |