C11H25NO2 — CID 96980936
2-[[(3R,5S)-5-methylheptan-3-yl]amino]propane-1,3-diol (PubChem CID 96980936) has the molecular formula C11H25NO2 and a molecular weight of 203.33 g/mol. Its IUPAC name is 2-[[(3R,5S)-5-methylheptan-3-yl]amino]propane-1,3-diol.
| Compound Name | 2-[[(3R,5S)-5-methylheptan-3-yl]amino]propane-1,3-diol |
|---|---|
| PubChem CID | 96980936 |
| Molecular Formula | C11H25NO2 |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.19 |
| IUPAC Name | 2-[[(3R,5S)-5-methylheptan-3-yl]amino]propane-1,3-diol |
| SMILES | CC[C@H](C)C[C@@H](CC)NC(CO)CO |
| InChI | InChI=1S/C11H25NO2/c1-4-9(3)6-10(5-2)12-11(7-13)8-14/h9-14H,4-8H2,1-3H3/t9-,10+/m0/s1 |
| InChIKey | OBEQEMNDISCMLH-VHSXEESVSA-N |
| XLogP | 1.14 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |