C9H21NO2 — CID 96980583
2-[[(2S,3R)-3-methylpentan-2-yl]amino]propane-1,3-diol (PubChem CID 96980583) has the molecular formula C9H21NO2 and a molecular weight of 175.27 g/mol. Its IUPAC name is 2-[[(2S,3R)-3-methylpentan-2-yl]amino]propane-1,3-diol.
| Compound Name | 2-[[(2S,3R)-3-methylpentan-2-yl]amino]propane-1,3-diol |
|---|---|
| PubChem CID | 96980583 |
| Molecular Formula | C9H21NO2 |
| Molecular Weight | 175.27 g/mol |
| Exact Mass | 175.16 |
| IUPAC Name | 2-[[(2S,3R)-3-methylpentan-2-yl]amino]propane-1,3-diol |
| SMILES | CC[C@@H](C)[C@H](C)NC(CO)CO |
| InChI | InChI=1S/C9H21NO2/c1-4-7(2)8(3)10-9(5-11)6-12/h7-12H,4-6H2,1-3H3/t7-,8+/m1/s1 |
| InChIKey | RBEAVIPKMIJVQS-SFYZADRCSA-N |
| XLogP | 0.36 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.27 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |