C11H25NO — CID 97051592
(4S)-4-[[(2R,3R)-3-methylpentan-2-yl]amino]pentan-1-ol (PubChem CID 97051592) has the molecular formula C11H25NO and a molecular weight of 187.33 g/mol. Its IUPAC name is (4S)-4-[[(2R,3R)-3-methylpentan-2-yl]amino]pentan-1-ol.
| Compound Name | (4S)-4-[[(2R,3R)-3-methylpentan-2-yl]amino]pentan-1-ol |
|---|---|
| PubChem CID | 97051592 |
| Molecular Formula | C11H25NO |
| Molecular Weight | 187.33 g/mol |
| Exact Mass | 187.19 |
| IUPAC Name | (4S)-4-[[(2R,3R)-3-methylpentan-2-yl]amino]pentan-1-ol |
| SMILES | CC[C@@H](C)[C@@H](C)N[C@@H](C)CCCO |
| InChI | InChI=1S/C11H25NO/c1-5-9(2)11(4)12-10(3)7-6-8-13/h9-13H,5-8H2,1-4H3/t9-,10+,11-/m1/s1 |
| InChIKey | PLPODTUXESQWBK-OUAUKWLOSA-N |
| XLogP | 2.17 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.33 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |