About ethyl 2-carbamoylhexanoate
ethyl 2-carbamoylhexanoate (PubChem CID 13444608) has the molecular formula C9H17NO3
and a molecular weight of 187.24 g/mol. Its IUPAC name is ethyl 2-carbamoylhexanoate.
Molecular Properties
| Compound Name | ethyl 2-carbamoylhexanoate |
| PubChem CID | 13444608 |
| Molecular Formula | C9H17NO3 |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.12 |
| IUPAC Name | ethyl 2-carbamoylhexanoate |
| SMILES | CCCCC(C(N)=O)C(=O)OCC |
| InChI | InChI=1S/C9H17NO3/c1-3-5-6-7(8(10)11)9(12)13-4-2/h7H,3-6H2,1-2H3,(H2,10,11) |
| InChIKey | VPJASAGRZOFXIG-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-carbamoylhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-carbamoylhexanoate?
The IUPAC name of ethyl 2-carbamoylhexanoate (CID 13444608) is ethyl 2-carbamoylhexanoate.
What is the SMILES notation for ethyl 2-carbamoylhexanoate?
The canonical SMILES for ethyl 2-carbamoylhexanoate is CCCCC(C(N)=O)C(=O)OCC.
What is the InChIKey of ethyl 2-carbamoylhexanoate?
The InChIKey is VPJASAGRZOFXIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO3/c1-3-5-6-7(8(10)11)9(12)13-4-2/h7H,3-6H2,1-2H3,(H2,10,11).
What are the key properties of ethyl 2-carbamoylhexanoate?
ethyl 2-carbamoylhexanoate has a molecular weight of 187.24 g/mol, XLogP of 0.84, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-carbamoylhexanoate is sourced from PubChem (CID 13444608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).