C24H45NO5 — CID 88825533
ethyl 12-acetyloxy-2-carbamoyl-13,13-dimethylheptadecanoate (PubChem CID 88825533) has the molecular formula C24H45NO5 and a molecular weight of 427.63 g/mol. Its IUPAC name is ethyl 12-acetyloxy-2-carbamoyl-13,13-dimethylheptadecanoate.
| Compound Name | ethyl 12-acetyloxy-2-carbamoyl-13,13-dimethylheptadecanoate |
|---|---|
| PubChem CID | 88825533 |
| Molecular Formula | C24H45NO5 |
| Molecular Weight | 427.63 g/mol |
| Exact Mass | 427.33 |
| IUPAC Name | ethyl 12-acetyloxy-2-carbamoyl-13,13-dimethylheptadecanoate |
| SMILES | CCCCC(C)(C)C(CCCCCCCCCC(C(N)=O)C(=O)OCC)OC(C)=O |
| InChI | InChI=1S/C24H45NO5/c1-6-8-18-24(4,5)21(30-19(3)26)17-15-13-11-9-10-12-14-16-20(22(25)27)23(28)29-7-2/h20-21H,6-18H2,1-5H3,(H2,25,27) |
| InChIKey | FJNNDYJONRKTHW-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.63 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|