C53H100O8 — CID 20793361
[3-(2-methylundecanoyloxy)-2,2-bis(2-methylundecanoyloxymethyl)propyl] 2-methylundecanoate (PubChem CID 20793361) has the molecular formula C53H100O8 and a molecular weight of 865.37 g/mol. Its IUPAC name is [3-(2-methylundecanoyloxy)-2,2-bis(2-methylundecanoyloxymethyl)propyl] 2-methylundecanoate.
| Compound Name | [3-(2-methylundecanoyloxy)-2,2-bis(2-methylundecanoyloxymethyl)propyl] 2-methylundecanoate |
|---|---|
| PubChem CID | 20793361 |
| Molecular Formula | C53H100O8 |
| Molecular Weight | 865.37 g/mol |
| Exact Mass | 864.74 |
| IUPAC Name | [3-(2-methylundecanoyloxy)-2,2-bis(2-methylundecanoyloxymethyl)propyl] 2-methylundecanoate |
| SMILES | CCCCCCCCCC(C)C(=O)OCC(COC(=O)C(C)CCCCCCCCC)(COC(=O)C(C)CCCCCCCCC)COC(=O)C(C)CCCCCCCCC |
| InChI | InChI=1S/C53H100O8/c1-9-13-17-21-25-29-33-37-45(5)49(54)58-41-53(42-59-50(55)46(6)38-34-30-26-22-18-14-10-2,43-60-51(56)47(7)39-35-31-27-23-19-15-11-3)44-61-52(57)48(8)40-36-32-28-24-20-16-12-4/h45-48H,9-44H2,1-8H3 |
| InChIKey | UCPRHHQUAJSRSP-UHFFFAOYSA-N |
| XLogP | 15.25 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 44 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 865.37 |
| LogP ≤ 5 | 15.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|