C37H70O6 — CID 11169447
[2-methyl-2,3-bis(2-methyldecanoyloxy)propyl] 2-methyldecanoate (PubChem CID 11169447) has the molecular formula C37H70O6 and a molecular weight of 610.96 g/mol. Its IUPAC name is [2-methyl-2,3-bis(2-methyldecanoyloxy)propyl] 2-methyldecanoate.
| Compound Name | [2-methyl-2,3-bis(2-methyldecanoyloxy)propyl] 2-methyldecanoate |
|---|---|
| PubChem CID | 11169447 |
| Molecular Formula | C37H70O6 |
| Molecular Weight | 610.96 g/mol |
| Exact Mass | 610.52 |
| IUPAC Name | [2-methyl-2,3-bis(2-methyldecanoyloxy)propyl] 2-methyldecanoate |
| SMILES | CCCCCCCCC(C)C(=O)OCC(C)(COC(=O)C(C)CCCCCCCC)OC(=O)C(C)CCCCCCCC |
| InChI | InChI=1S/C37H70O6/c1-8-11-14-17-20-23-26-31(4)34(38)41-29-37(7,43-36(40)33(6)28-25-22-19-16-13-10-3)30-42-35(39)32(5)27-24-21-18-15-12-9-2/h31-33H,8-30H2,1-7H3 |
| InChIKey | ODWMKJCGKKBIHD-UHFFFAOYSA-N |
| XLogP | 10.53 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.96 |
| LogP ≤ 5 | 10.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|