C69H132O8S4 — CID 22908306
[3-[3-(2-butyloctylsulfanyl)-2-methylpropanoyl]oxy-2,2-bis[[3-(2-butyloctylsulfanyl)-2-methylpropanoyl]oxymethyl]propyl] 3-(2-butyloctylsulfanyl)-2-methylpropanoate (PubChem CID 22908306) has the molecular formula C69H132O8S4 and a molecular weight of 1218.07 g/mol. Its IUPAC name is [3-[3-(2-butyloctylsulfanyl)-2-methylpropanoyl]oxy-2,2-bis[[3-(2-butyloctylsulfanyl)-2-methylpropanoyl]oxymethyl]propyl] 3-(2-butyloctylsulfanyl)-2-methylpropanoate.
| Compound Name | [3-[3-(2-butyloctylsulfanyl)-2-methylpropanoyl]oxy-2,2-bis[[3-(2-butyloctylsulfanyl)-2-methylpropanoyl]oxymethyl]propyl] 3-(2-butyloctylsulfanyl)-2-methylpropanoate |
|---|---|
| PubChem CID | 22908306 |
| Molecular Formula | C69H132O8S4 |
| Molecular Weight | 1218.07 g/mol |
| Exact Mass | 1216.88 |
| IUPAC Name | [3-[3-(2-butyloctylsulfanyl)-2-methylpropanoyl]oxy-2,2-bis[[3-(2-butyloctylsulfanyl)-2-methylpropanoyl]oxymethyl]propyl] 3-(2-butyloctylsulfanyl)-2-methylpropanoate |
| SMILES | CCCCCCC(CCCC)CSCC(C)C(=O)OCC(COC(=O)C(C)CSCC(CCCC)CCCCCC)(COC(=O)C(C)CSCC(CCCC)CCCCCC)COC(=O)C(C)CSCC(CCCC)CCCCCC |
| InChI | InChI=1S/C69H132O8S4/c1-13-21-29-33-41-61(37-25-17-5)49-78-45-57(9)65(70)74-53-69(54-75-66(71)58(10)46-79-50-62(38-26-18-6)42-34-30-22-14-2,55-76-67(72)59(11)47-80-51-63(39-27-19-7)43-35-31-23-15-3)56-77-68(73)60(12)48-81-52-64(40-28-20-8)44-36-32-24-16-4/h57-64H,13-56H2,1-12H3 |
| InChIKey | MFVSZLZRTCYVFY-UHFFFAOYSA-N |
| XLogP | 20.73 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 60 |
| Heavy Atoms | 81 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1218.07 |
| LogP ≤ 5 | 20.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|