C22H36O2S — CID 22908235
3-(2-butyloctylsulfanyl)-2-methyl-2-phenylpropanoic acid (PubChem CID 22908235) has the molecular formula C22H36O2S and a molecular weight of 364.59 g/mol. Its IUPAC name is 3-(2-butyloctylsulfanyl)-2-methyl-2-phenylpropanoic acid.
| Compound Name | 3-(2-butyloctylsulfanyl)-2-methyl-2-phenylpropanoic acid |
|---|---|
| PubChem CID | 22908235 |
| Molecular Formula | C22H36O2S |
| Molecular Weight | 364.59 g/mol |
| Exact Mass | 364.24 |
| IUPAC Name | 3-(2-butyloctylsulfanyl)-2-methyl-2-phenylpropanoic acid |
| SMILES | CCCCCCC(CCCC)CSCC(C)(C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C22H36O2S/c1-4-6-8-10-14-19(13-7-5-2)17-25-18-22(3,21(23)24)20-15-11-9-12-16-20/h9,11-12,15-16,19H,4-8,10,13-14,17-18H2,1-3H3,(H,23,24) |
| InChIKey | QLMXVECFJZHTAO-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.59 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|