About 2-aminoethanol;icosanamide
2-aminoethanol;icosanamide (PubChem CID 157409605) has the molecular formula C22H48N2O2
and a molecular weight of 372.64 g/mol. Its IUPAC name is 2-aminoethanol;icosanamide.
Molecular Properties
| Compound Name | 2-aminoethanol;icosanamide |
| PubChem CID | 157409605 |
| Molecular Formula | C22H48N2O2 |
| Molecular Weight | 372.64 g/mol |
| Exact Mass | 372.37 |
| IUPAC Name | 2-aminoethanol;icosanamide |
| SMILES | CCCCCCCCCCCCCCCCCCCC(N)=O.NCCO |
| InChI | InChI=1S/C20H41NO.C2H7NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22;3-1-2-4/h2-19H2,1H3,(H2,21,22);4H,1-3H2 |
| InChIKey | BOCUEGQXUUGJLR-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 89.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 372.64 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-aminoethanol;icosanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoethanol;icosanamide?
The IUPAC name of 2-aminoethanol;icosanamide (CID 157409605) is 2-aminoethanol;icosanamide.
What is the SMILES notation for 2-aminoethanol;icosanamide?
The canonical SMILES for 2-aminoethanol;icosanamide is CCCCCCCCCCCCCCCCCCCC(N)=O.NCCO.
What is the InChIKey of 2-aminoethanol;icosanamide?
The InChIKey is BOCUEGQXUUGJLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H41NO.C2H7NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22;3-1-2-4/h2-19H2,1H3,(H2,21,22);4H,1-3H2.
What are the key properties of 2-aminoethanol;icosanamide?
2-aminoethanol;icosanamide has a molecular weight of 372.64 g/mol, XLogP of 5.45, 19 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoethanol;icosanamide is sourced from PubChem (CID 157409605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).