About 2-(dimethylamino)propanoic acid;1-hydroxysulfanylpropane
2-(dimethylamino)propanoic acid;1-hydroxysulfanylpropane (PubChem CID 174640798) has the molecular formula C8H19NO3S
and a molecular weight of 209.31 g/mol. Its IUPAC name is 2-(dimethylamino)propanoic acid;1-hydroxysulfanylpropane.
Molecular Properties
| Compound Name | 2-(dimethylamino)propanoic acid;1-hydroxysulfanylpropane |
| PubChem CID | 174640798 |
| Molecular Formula | C8H19NO3S |
| Molecular Weight | 209.31 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | 2-(dimethylamino)propanoic acid;1-hydroxysulfanylpropane |
| SMILES | CC(C(=O)O)N(C)C.CCCSO |
| InChI | InChI=1S/C5H11NO2.C3H8OS/c1-4(5(7)8)6(2)3;1-2-3-5-4/h4H,1-3H3,(H,7,8);4H,2-3H2,1H3 |
| InChIKey | SYMXEBWFVBPVAL-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.31 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(dimethylamino)propanoic acid;1-hydroxysulfanylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethylamino)propanoic acid;1-hydroxysulfanylpropane?
The IUPAC name of 2-(dimethylamino)propanoic acid;1-hydroxysulfanylpropane (CID 174640798) is 2-(dimethylamino)propanoic acid;1-hydroxysulfanylpropane.
What is the SMILES notation for 2-(dimethylamino)propanoic acid;1-hydroxysulfanylpropane?
The canonical SMILES for 2-(dimethylamino)propanoic acid;1-hydroxysulfanylpropane is CC(C(=O)O)N(C)C.CCCSO.
What is the InChIKey of 2-(dimethylamino)propanoic acid;1-hydroxysulfanylpropane?
The InChIKey is SYMXEBWFVBPVAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NO2.C3H8OS/c1-4(5(7)8)6(2)3;1-2-3-5-4/h4H,1-3H3,(H,7,8);4H,2-3H2,1H3.
What are the key properties of 2-(dimethylamino)propanoic acid;1-hydroxysulfanylpropane?
2-(dimethylamino)propanoic acid;1-hydroxysulfanylpropane has a molecular weight of 209.31 g/mol, XLogP of 1.62, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylamino)propanoic acid;1-hydroxysulfanylpropane is sourced from PubChem (CID 174640798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).