C33H22Cl2F7N3O3S — CID 19306954
N-[(E)-1-(2,4-dichlorophenyl)-3-oxo-3-[3-[1-oxo-1-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]butan-2-yl]sulfanylanilino]prop-1-en-2-yl]benzamide (PubChem CID 19306954) has the molecular formula C33H22Cl2F7N3O3S and a molecular weight of 744.52 g/mol. Its IUPAC name is N-[(E)-1-(2,4-dichlorophenyl)-3-oxo-3-[3-[1-oxo-1-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]butan-2-yl]sulfanylanilino]prop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-1-(2,4-dichlorophenyl)-3-oxo-3-[3-[1-oxo-1-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]butan-2-yl]sulfanylanilino]prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19306954 |
| Molecular Formula | C33H22Cl2F7N3O3S |
| Molecular Weight | 744.52 g/mol |
| Exact Mass | 743.06 |
| IUPAC Name | N-[(E)-1-(2,4-dichlorophenyl)-3-oxo-3-[3-[1-oxo-1-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]butan-2-yl]sulfanylanilino]prop-1-en-2-yl]benzamide |
| SMILES | CCC(Sc1cccc(NC(=O)/C(=C\c2ccc(Cl)cc2Cl)NC(=O)c2ccccc2)c1)C(=O)Nc1c(F)c(F)c(C(F)(F)F)c(F)c1F |
| InChI | InChI=1S/C33H22Cl2F7N3O3S/c1-2-23(32(48)45-29-27(38)25(36)24(33(40,41)42)26(37)28(29)39)49-20-10-6-9-19(15-20)43-31(47)22(13-17-11-12-18(34)14-21(17)35)44-30(46)16-7-4-3-5-8-16/h3-15,23H,2H2,1H3,(H,43,47)(H,44,46)(H,45,48)/b22-13+ |
| InChIKey | JDIWUTMALHDIDW-LPYMAVHISA-N |
| XLogP | 9.49 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.52 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|