C37H26F7N3O3S — CID 19311562
N-[(E)-1-naphthalen-1-yl-3-oxo-3-[3-[1-oxo-1-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]butan-2-yl]sulfanylanilino]prop-1-en-2-yl]benzamide (PubChem CID 19311562) has the molecular formula C37H26F7N3O3S and a molecular weight of 725.69 g/mol. Its IUPAC name is N-[(E)-1-naphthalen-1-yl-3-oxo-3-[3-[1-oxo-1-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]butan-2-yl]sulfanylanilino]prop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-1-naphthalen-1-yl-3-oxo-3-[3-[1-oxo-1-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]butan-2-yl]sulfanylanilino]prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19311562 |
| Molecular Formula | C37H26F7N3O3S |
| Molecular Weight | 725.69 g/mol |
| Exact Mass | 725.16 |
| IUPAC Name | N-[(E)-1-naphthalen-1-yl-3-oxo-3-[3-[1-oxo-1-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]butan-2-yl]sulfanylanilino]prop-1-en-2-yl]benzamide |
| SMILES | CCC(Sc1cccc(NC(=O)/C(=C\c2cccc3ccccc23)NC(=O)c2ccccc2)c1)C(=O)Nc1c(F)c(F)c(C(F)(F)F)c(F)c1F |
| InChI | InChI=1S/C37H26F7N3O3S/c1-2-27(36(50)47-33-31(40)29(38)28(37(42,43)44)30(39)32(33)41)51-24-16-9-15-23(19-24)45-35(49)26(46-34(48)21-11-4-3-5-12-21)18-22-14-8-13-20-10-6-7-17-25(20)22/h3-19,27H,2H2,1H3,(H,45,49)(H,46,48)(H,47,50)/b26-18+ |
| InChIKey | BLCRRUHHLDRZIX-NLRVBDNBSA-N |
| XLogP | 9.33 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.69 |
| LogP ≤ 5 | 9.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|