C26H23BrN4OS3 — CID 19316009
N-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-2-[3-(phenylcarbamothioylamino)phenyl]sulfanylbutanamide (PubChem CID 19316009) has the molecular formula C26H23BrN4OS3 and a molecular weight of 583.60 g/mol. Its IUPAC name is N-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-2-[3-(phenylcarbamothioylamino)phenyl]sulfanylbutanamide.
| Compound Name | N-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-2-[3-(phenylcarbamothioylamino)phenyl]sulfanylbutanamide |
|---|---|
| PubChem CID | 19316009 |
| Molecular Formula | C26H23BrN4OS3 |
| Molecular Weight | 583.60 g/mol |
| Exact Mass | 582.02 |
| IUPAC Name | N-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-2-[3-(phenylcarbamothioylamino)phenyl]sulfanylbutanamide |
| SMILES | CCC(Sc1cccc(NC(=S)Nc2ccccc2)c1)C(=O)Nc1nc(-c2ccc(Br)cc2)cs1 |
| InChI | InChI=1S/C26H23BrN4OS3/c1-2-23(24(32)31-26-30-22(16-34-26)17-11-13-18(27)14-12-17)35-21-10-6-9-20(15-21)29-25(33)28-19-7-4-3-5-8-19/h3-16,23H,2H2,1H3,(H2,28,29,33)(H,30,31,32) |
| InChIKey | KTRCPOUYKMEGNA-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.60 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|