C21H23N5OS4 — CID 19318044
N-(3-ethylsulfanyl-1,2,4-thiadiazol-5-yl)-2-[3-(phenylcarbamothioylamino)phenyl]sulfanylbutanamide (PubChem CID 19318044) has the molecular formula C21H23N5OS4 and a molecular weight of 489.72 g/mol. Its IUPAC name is N-(3-ethylsulfanyl-1,2,4-thiadiazol-5-yl)-2-[3-(phenylcarbamothioylamino)phenyl]sulfanylbutanamide.
| Compound Name | N-(3-ethylsulfanyl-1,2,4-thiadiazol-5-yl)-2-[3-(phenylcarbamothioylamino)phenyl]sulfanylbutanamide |
|---|---|
| PubChem CID | 19318044 |
| Molecular Formula | C21H23N5OS4 |
| Molecular Weight | 489.72 g/mol |
| Exact Mass | 489.08 |
| IUPAC Name | N-(3-ethylsulfanyl-1,2,4-thiadiazol-5-yl)-2-[3-(phenylcarbamothioylamino)phenyl]sulfanylbutanamide |
| SMILES | CCSc1nsc(NC(=O)C(CC)Sc2cccc(NC(=S)Nc3ccccc3)c2)n1 |
| InChI | InChI=1S/C21H23N5OS4/c1-3-17(18(27)24-20-25-21(26-31-20)29-4-2)30-16-12-8-11-15(13-16)23-19(28)22-14-9-6-5-7-10-14/h5-13,17H,3-4H2,1-2H3,(H2,22,23,28)(H,24,25,26,27) |
| InChIKey | KYQZLFCOMYSCHH-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.72 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|