C31H28N2O2S — CID 18902029
(E)-N-[3-[2-(2,4-dimethylanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]-3-phenylprop-2-enamide (PubChem CID 18902029) has the molecular formula C31H28N2O2S and a molecular weight of 492.64 g/mol. Its IUPAC name is (E)-N-[3-[2-(2,4-dimethylanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[3-[2-(2,4-dimethylanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 18902029 |
| Molecular Formula | C31H28N2O2S |
| Molecular Weight | 492.64 g/mol |
| Exact Mass | 492.19 |
| IUPAC Name | (E)-N-[3-[2-(2,4-dimethylanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]-3-phenylprop-2-enamide |
| SMILES | Cc1ccc(NC(=O)C(Sc2cccc(NC(=O)/C=C/c3ccccc3)c2)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C31H28N2O2S/c1-22-16-18-28(23(2)20-22)33-31(35)30(25-12-7-4-8-13-25)36-27-15-9-14-26(21-27)32-29(34)19-17-24-10-5-3-6-11-24/h3-21,30H,1-2H3,(H,32,34)(H,33,35)/b19-17+ |
| InChIKey | KJBKNZCXGBDLJA-HTXNQAPBSA-N |
| XLogP | 7.43 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.64 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|