C14H24N4O4S — CID 154908393
2-amino-N-[3-[2-(hydroxymethyl)piperidin-1-yl]propyl]-1,3-thiazole-4-carboxamide;formic acid (PubChem CID 154908393) has the molecular formula C14H24N4O4S and a molecular weight of 344.44 g/mol. Its IUPAC name is 2-amino-N-[3-[2-(hydroxymethyl)piperidin-1-yl]propyl]-1,3-thiazole-4-carboxamide;formic acid.
| Compound Name | 2-amino-N-[3-[2-(hydroxymethyl)piperidin-1-yl]propyl]-1,3-thiazole-4-carboxamide;formic acid |
|---|---|
| PubChem CID | 154908393 |
| Molecular Formula | C14H24N4O4S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | 2-amino-N-[3-[2-(hydroxymethyl)piperidin-1-yl]propyl]-1,3-thiazole-4-carboxamide;formic acid |
| SMILES | Nc1nc(C(=O)NCCCN2CCCCC2CO)cs1.O=CO |
| InChI | InChI=1S/C13H22N4O2S.CH2O2/c14-13-16-11(9-20-13)12(19)15-5-3-7-17-6-2-1-4-10(17)8-18;2-1-3/h9-10,18H,1-8H2,(H2,14,16)(H,15,19);1H,(H,2,3) |
| InChIKey | SGPWZHNELFLSEX-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 128.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|