C11H16BrNO2S — CID 103885780
[(2S)-1-[(4-bromo-5-methoxythiophen-2-yl)methyl]pyrrolidin-2-yl]methanol (PubChem CID 103885780) has the molecular formula C11H16BrNO2S and a molecular weight of 306.23 g/mol. Its IUPAC name is [(2S)-1-[(4-bromo-5-methoxythiophen-2-yl)methyl]pyrrolidin-2-yl]methanol.
| Compound Name | [(2S)-1-[(4-bromo-5-methoxythiophen-2-yl)methyl]pyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 103885780 |
| Molecular Formula | C11H16BrNO2S |
| Molecular Weight | 306.23 g/mol |
| Exact Mass | 305.01 |
| IUPAC Name | [(2S)-1-[(4-bromo-5-methoxythiophen-2-yl)methyl]pyrrolidin-2-yl]methanol |
| SMILES | COc1sc(CN2CCC[C@H]2CO)cc1Br |
| InChI | InChI=1S/C11H16BrNO2S/c1-15-11-10(12)5-9(16-11)6-13-4-2-3-8(13)7-14/h5,8,14H,2-4,6-7H2,1H3/t8-/m0/s1 |
| InChIKey | GTODFOGXZLOVNI-QMMMGPOBSA-N |
| XLogP | 2.48 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.23 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |