C11H16BrNOS — CID 103885793
[(2S)-1-[(5-bromo-4-methylthiophen-2-yl)methyl]pyrrolidin-2-yl]methanol (PubChem CID 103885793) has the molecular formula C11H16BrNOS and a molecular weight of 290.23 g/mol. Its IUPAC name is [(2S)-1-[(5-bromo-4-methylthiophen-2-yl)methyl]pyrrolidin-2-yl]methanol.
| Compound Name | [(2S)-1-[(5-bromo-4-methylthiophen-2-yl)methyl]pyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 103885793 |
| Molecular Formula | C11H16BrNOS |
| Molecular Weight | 290.23 g/mol |
| Exact Mass | 289.01 |
| IUPAC Name | [(2S)-1-[(5-bromo-4-methylthiophen-2-yl)methyl]pyrrolidin-2-yl]methanol |
| SMILES | Cc1cc(CN2CCC[C@H]2CO)sc1Br |
| InChI | InChI=1S/C11H16BrNOS/c1-8-5-10(15-11(8)12)6-13-4-2-3-9(13)7-14/h5,9,14H,2-4,6-7H2,1H3/t9-/m0/s1 |
| InChIKey | OYPXMUNVWWEWSV-VIFPVBQESA-N |
| XLogP | 2.78 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.23 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |