C15H16ClNS — CID 55506302
1-[(5-chlorothiophen-2-yl)methyl]-2-phenylpyrrolidine (PubChem CID 55506302) has the molecular formula C15H16ClNS and a molecular weight of 277.82 g/mol. Its IUPAC name is 1-[(5-chlorothiophen-2-yl)methyl]-2-phenylpyrrolidine.
| Compound Name | 1-[(5-chlorothiophen-2-yl)methyl]-2-phenylpyrrolidine |
|---|---|
| PubChem CID | 55506302 |
| Molecular Formula | C15H16ClNS |
| Molecular Weight | 277.82 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | 1-[(5-chlorothiophen-2-yl)methyl]-2-phenylpyrrolidine |
| SMILES | Clc1ccc(CN2CCCC2c2ccccc2)s1 |
| InChI | InChI=1S/C15H16ClNS/c16-15-9-8-13(18-15)11-17-10-4-7-14(17)12-5-2-1-3-6-12/h1-3,5-6,8-9,14H,4,7,10-11H2 |
| InChIKey | CTHODIPRZCBZPX-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.82 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |