C17H21ClN2O2S2 — CID 45192185
5-[1-[(5-chlorothiophen-2-yl)methyl]pyrrolidin-2-yl]-N-(2-methoxyethyl)thiophene-2-carboxamide (PubChem CID 45192185) has the molecular formula C17H21ClN2O2S2 and a molecular weight of 384.95 g/mol. Its IUPAC name is 5-[1-[(5-chlorothiophen-2-yl)methyl]pyrrolidin-2-yl]-N-(2-methoxyethyl)thiophene-2-carboxamide.
| Compound Name | 5-[1-[(5-chlorothiophen-2-yl)methyl]pyrrolidin-2-yl]-N-(2-methoxyethyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 45192185 |
| Molecular Formula | C17H21ClN2O2S2 |
| Molecular Weight | 384.95 g/mol |
| Exact Mass | 384.07 |
| IUPAC Name | 5-[1-[(5-chlorothiophen-2-yl)methyl]pyrrolidin-2-yl]-N-(2-methoxyethyl)thiophene-2-carboxamide |
| SMILES | COCCNC(=O)c1ccc(C2CCCN2Cc2ccc(Cl)s2)s1 |
| InChI | InChI=1S/C17H21ClN2O2S2/c1-22-10-8-19-17(21)15-6-5-14(24-15)13-3-2-9-20(13)11-12-4-7-16(18)23-12/h4-7,13H,2-3,8-11H2,1H3,(H,19,21) |
| InChIKey | JPPLCNVZIOOFRP-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.95 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|