C20H22N4O2S — CID 45206718
5-[1-(furan-3-ylmethyl)pyrrolidin-2-yl]-N-(2-pyrazin-2-ylethyl)thiophene-2-carboxamide (PubChem CID 45206718) has the molecular formula C20H22N4O2S and a molecular weight of 382.49 g/mol. Its IUPAC name is 5-[1-(furan-3-ylmethyl)pyrrolidin-2-yl]-N-(2-pyrazin-2-ylethyl)thiophene-2-carboxamide.
| Compound Name | 5-[1-(furan-3-ylmethyl)pyrrolidin-2-yl]-N-(2-pyrazin-2-ylethyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 45206718 |
| Molecular Formula | C20H22N4O2S |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | 5-[1-(furan-3-ylmethyl)pyrrolidin-2-yl]-N-(2-pyrazin-2-ylethyl)thiophene-2-carboxamide |
| SMILES | O=C(NCCc1cnccn1)c1ccc(C2CCCN2Cc2ccoc2)s1 |
| InChI | InChI=1S/C20H22N4O2S/c25-20(23-7-5-16-12-21-8-9-22-16)19-4-3-18(27-19)17-2-1-10-24(17)13-15-6-11-26-14-15/h3-4,6,8-9,11-12,14,17H,1-2,5,7,10,13H2,(H,23,25) |
| InChIKey | YMCHPGKSIVUCPF-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |