C18H28N6OS — CID 45227389
5-[1-(2,2-dimethylpropyl)pyrrolidin-2-yl]-N-[3-(2H-tetrazol-5-yl)propyl]thiophene-2-carboxamide (PubChem CID 45227389) has the molecular formula C18H28N6OS and a molecular weight of 376.53 g/mol. Its IUPAC name is 5-[1-(2,2-dimethylpropyl)pyrrolidin-2-yl]-N-[3-(2H-tetrazol-5-yl)propyl]thiophene-2-carboxamide.
| Compound Name | 5-[1-(2,2-dimethylpropyl)pyrrolidin-2-yl]-N-[3-(2H-tetrazol-5-yl)propyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 45227389 |
| Molecular Formula | C18H28N6OS |
| Molecular Weight | 376.53 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | 5-[1-(2,2-dimethylpropyl)pyrrolidin-2-yl]-N-[3-(2H-tetrazol-5-yl)propyl]thiophene-2-carboxamide |
| SMILES | CC(C)(C)CN1CCCC1c1ccc(C(=O)NCCCc2nn[nH]n2)s1 |
| InChI | InChI=1S/C18H28N6OS/c1-18(2,3)12-24-11-5-6-13(24)14-8-9-15(26-14)17(25)19-10-4-7-16-20-22-23-21-16/h8-9,13H,4-7,10-12H2,1-3H3,(H,19,25)(H,20,21,22,23) |
| InChIKey | FQOIQXDWFHGKGQ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.53 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|