C16H23N5OS2 — CID 45199086
5-(1-propylpyrrolidin-2-yl)-N-[2-(2H-triazol-4-ylsulfanyl)ethyl]thiophene-2-carboxamide (PubChem CID 45199086) has the molecular formula C16H23N5OS2 and a molecular weight of 365.53 g/mol. Its IUPAC name is 5-(1-propylpyrrolidin-2-yl)-N-[2-(2H-triazol-4-ylsulfanyl)ethyl]thiophene-2-carboxamide.
| Compound Name | 5-(1-propylpyrrolidin-2-yl)-N-[2-(2H-triazol-4-ylsulfanyl)ethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 45199086 |
| Molecular Formula | C16H23N5OS2 |
| Molecular Weight | 365.53 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | 5-(1-propylpyrrolidin-2-yl)-N-[2-(2H-triazol-4-ylsulfanyl)ethyl]thiophene-2-carboxamide |
| SMILES | CCCN1CCCC1c1ccc(C(=O)NCCSc2cn[nH]n2)s1 |
| InChI | InChI=1S/C16H23N5OS2/c1-2-8-21-9-3-4-12(21)13-5-6-14(24-13)16(22)17-7-10-23-15-11-18-20-19-15/h5-6,11-12H,2-4,7-10H2,1H3,(H,17,22)(H,18,19,20) |
| InChIKey | CQYVESSGWXEZJD-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.53 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|