C12H20N6O2S — CID 70733358
1-[2-oxo-2-[2-(2H-triazol-4-ylsulfanyl)ethylamino]ethyl]piperidine-4-carboxamide (PubChem CID 70733358) has the molecular formula C12H20N6O2S and a molecular weight of 312.40 g/mol. Its IUPAC name is 1-[2-oxo-2-[2-(2H-triazol-4-ylsulfanyl)ethylamino]ethyl]piperidine-4-carboxamide.
| Compound Name | 1-[2-oxo-2-[2-(2H-triazol-4-ylsulfanyl)ethylamino]ethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 70733358 |
| Molecular Formula | C12H20N6O2S |
| Molecular Weight | 312.40 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | 1-[2-oxo-2-[2-(2H-triazol-4-ylsulfanyl)ethylamino]ethyl]piperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN(CC(=O)NCCSc2cn[nH]n2)CC1 |
| InChI | InChI=1S/C12H20N6O2S/c13-12(20)9-1-4-18(5-2-9)8-10(19)14-3-6-21-11-7-15-17-16-11/h7,9H,1-6,8H2,(H2,13,20)(H,14,19)(H,15,16,17) |
| InChIKey | ZOGRATUSXDOMBW-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.40 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|