C17H28N6O2S — CID 95725736
2-[(2R)-1-(cyclohexylmethyl)-3-oxopiperazin-2-yl]-N-[2-(2H-triazol-4-ylsulfanyl)ethyl]acetamide (PubChem CID 95725736) has the molecular formula C17H28N6O2S and a molecular weight of 380.52 g/mol. Its IUPAC name is 2-[(2R)-1-(cyclohexylmethyl)-3-oxopiperazin-2-yl]-N-[2-(2H-triazol-4-ylsulfanyl)ethyl]acetamide.
| Compound Name | 2-[(2R)-1-(cyclohexylmethyl)-3-oxopiperazin-2-yl]-N-[2-(2H-triazol-4-ylsulfanyl)ethyl]acetamide |
|---|---|
| PubChem CID | 95725736 |
| Molecular Formula | C17H28N6O2S |
| Molecular Weight | 380.52 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | 2-[(2R)-1-(cyclohexylmethyl)-3-oxopiperazin-2-yl]-N-[2-(2H-triazol-4-ylsulfanyl)ethyl]acetamide |
| SMILES | O=C(C[C@@H]1C(=O)NCCN1CC1CCCCC1)NCCSc1cn[nH]n1 |
| InChI | InChI=1S/C17H28N6O2S/c24-15(18-7-9-26-16-11-20-22-21-16)10-14-17(25)19-6-8-23(14)12-13-4-2-1-3-5-13/h11,13-14H,1-10,12H2,(H,18,24)(H,19,25)(H,20,21,22)/t14-/m1/s1 |
| InChIKey | WDQUSPQCVHNIHN-CQSZACIVSA-N |
| XLogP | 0.78 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.52 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|