C12H21N5O2S — CID 50962383
ethyl 4-[2-(2H-triazol-4-ylsulfanyl)ethylamino]piperidine-1-carboxylate (PubChem CID 50962383) has the molecular formula C12H21N5O2S and a molecular weight of 299.40 g/mol. Its IUPAC name is ethyl 4-[2-(2H-triazol-4-ylsulfanyl)ethylamino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[2-(2H-triazol-4-ylsulfanyl)ethylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 50962383 |
| Molecular Formula | C12H21N5O2S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | ethyl 4-[2-(2H-triazol-4-ylsulfanyl)ethylamino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NCCSc2cn[nH]n2)CC1 |
| InChI | InChI=1S/C12H21N5O2S/c1-2-19-12(18)17-6-3-10(4-7-17)13-5-8-20-11-9-14-16-15-11/h9-10,13H,2-8H2,1H3,(H,14,15,16) |
| InChIKey | SVAGBKNSDTVHHE-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|