C15H20N6OS — CID 126433364
(2S)-2-pyridin-3-yl-N-[2-(2H-triazol-4-ylsulfanyl)ethyl]piperidine-1-carboxamide (PubChem CID 126433364) has the molecular formula C15H20N6OS and a molecular weight of 332.43 g/mol. Its IUPAC name is (2S)-2-pyridin-3-yl-N-[2-(2H-triazol-4-ylsulfanyl)ethyl]piperidine-1-carboxamide.
| Compound Name | (2S)-2-pyridin-3-yl-N-[2-(2H-triazol-4-ylsulfanyl)ethyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 126433364 |
| Molecular Formula | C15H20N6OS |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | (2S)-2-pyridin-3-yl-N-[2-(2H-triazol-4-ylsulfanyl)ethyl]piperidine-1-carboxamide |
| SMILES | O=C(NCCSc1cn[nH]n1)N1CCCC[C@H]1c1cccnc1 |
| InChI | InChI=1S/C15H20N6OS/c22-15(17-7-9-23-14-11-18-20-19-14)21-8-2-1-5-13(21)12-4-3-6-16-10-12/h3-4,6,10-11,13H,1-2,5,7-9H2,(H,17,22)(H,18,19,20)/t13-/m0/s1 |
| InChIKey | PPUNWKSGFIPUGA-ZDUSSCGKSA-N |
| XLogP | 2.23 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|