C16H18N4O2 — CID 74249642
2-methyl-6-(2-pyridin-3-ylpiperidine-1-carbonyl)pyridazin-3-one (PubChem CID 74249642) has the molecular formula C16H18N4O2 and a molecular weight of 298.35 g/mol. Its IUPAC name is 2-methyl-6-(2-pyridin-3-ylpiperidine-1-carbonyl)pyridazin-3-one.
| Compound Name | 2-methyl-6-(2-pyridin-3-ylpiperidine-1-carbonyl)pyridazin-3-one |
|---|---|
| PubChem CID | 74249642 |
| Molecular Formula | C16H18N4O2 |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 2-methyl-6-(2-pyridin-3-ylpiperidine-1-carbonyl)pyridazin-3-one |
| SMILES | Cn1nc(C(=O)N2CCCCC2c2cccnc2)ccc1=O |
| InChI | InChI=1S/C16H18N4O2/c1-19-15(21)8-7-13(18-19)16(22)20-10-3-2-6-14(20)12-5-4-9-17-11-12/h4-5,7-9,11,14H,2-3,6,10H2,1H3 |
| InChIKey | GCJDMFTZSGOXQG-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |