C22H34N4O2 — CID 126423361
(2R)-N-[(1-morpholin-4-ylcyclohexyl)methyl]-2-pyridin-3-ylpiperidine-1-carboxamide (PubChem CID 126423361) has the molecular formula C22H34N4O2 and a molecular weight of 386.54 g/mol. Its IUPAC name is (2R)-N-[(1-morpholin-4-ylcyclohexyl)methyl]-2-pyridin-3-ylpiperidine-1-carboxamide.
| Compound Name | (2R)-N-[(1-morpholin-4-ylcyclohexyl)methyl]-2-pyridin-3-ylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 126423361 |
| Molecular Formula | C22H34N4O2 |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.27 |
| IUPAC Name | (2R)-N-[(1-morpholin-4-ylcyclohexyl)methyl]-2-pyridin-3-ylpiperidine-1-carboxamide |
| SMILES | O=C(NCC1(N2CCOCC2)CCCCC1)N1CCCC[C@@H]1c1cccnc1 |
| InChI | InChI=1S/C22H34N4O2/c27-21(26-12-5-2-8-20(26)19-7-6-11-23-17-19)24-18-22(9-3-1-4-10-22)25-13-15-28-16-14-25/h6-7,11,17,20H,1-5,8-10,12-16,18H2,(H,24,27)/t20-/m1/s1 |
| InChIKey | LAKAMMJECCEMBV-HXUWFJFHSA-N |
| XLogP | 3.35 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |