C21H25N3O2 — CID 139004180
N-[[1-(3-methoxyphenyl)cyclopropyl]methyl]-2-pyridin-3-ylpyrrolidine-1-carboxamide (PubChem CID 139004180) has the molecular formula C21H25N3O2 and a molecular weight of 351.45 g/mol. Its IUPAC name is N-[[1-(3-methoxyphenyl)cyclopropyl]methyl]-2-pyridin-3-ylpyrrolidine-1-carboxamide.
| Compound Name | N-[[1-(3-methoxyphenyl)cyclopropyl]methyl]-2-pyridin-3-ylpyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 139004180 |
| Molecular Formula | C21H25N3O2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | N-[[1-(3-methoxyphenyl)cyclopropyl]methyl]-2-pyridin-3-ylpyrrolidine-1-carboxamide |
| SMILES | COc1cccc(C2(CNC(=O)N3CCCC3c3cccnc3)CC2)c1 |
| InChI | InChI=1S/C21H25N3O2/c1-26-18-7-2-6-17(13-18)21(9-10-21)15-23-20(25)24-12-4-8-19(24)16-5-3-11-22-14-16/h2-3,5-7,11,13-14,19H,4,8-10,12,15H2,1H3,(H,23,25) |
| InChIKey | UKQMUWBWYLLDLF-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |