C12H22N6O — CID 126442269
(3S)-1-ethyl-N-[3-(2H-tetrazol-5-yl)propyl]piperidine-3-carboxamide (PubChem CID 126442269) has the molecular formula C12H22N6O and a molecular weight of 266.35 g/mol. Its IUPAC name is (3S)-1-ethyl-N-[3-(2H-tetrazol-5-yl)propyl]piperidine-3-carboxamide.
| Compound Name | (3S)-1-ethyl-N-[3-(2H-tetrazol-5-yl)propyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 126442269 |
| Molecular Formula | C12H22N6O |
| Molecular Weight | 266.35 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | (3S)-1-ethyl-N-[3-(2H-tetrazol-5-yl)propyl]piperidine-3-carboxamide |
| SMILES | CCN1CCC[C@H](C(=O)NCCCc2nn[nH]n2)C1 |
| InChI | InChI=1S/C12H22N6O/c1-2-18-8-4-5-10(9-18)12(19)13-7-3-6-11-14-16-17-15-11/h10H,2-9H2,1H3,(H,13,19)(H,14,15,16,17)/t10-/m0/s1 |
| InChIKey | WWBQTWRMJXKJPY-JTQLQIEISA-N |
| XLogP | -0.02 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.35 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|