C22H23N3OS — CID 28980406
5-[(2R)-1-[(2-methylphenyl)methyl]pyrrolidin-2-yl]-N-pyridin-4-ylthiophene-2-carboxamide (PubChem CID 28980406) has the molecular formula C22H23N3OS and a molecular weight of 377.51 g/mol. Its IUPAC name is 5-[(2R)-1-[(2-methylphenyl)methyl]pyrrolidin-2-yl]-N-pyridin-4-ylthiophene-2-carboxamide.
| Compound Name | 5-[(2R)-1-[(2-methylphenyl)methyl]pyrrolidin-2-yl]-N-pyridin-4-ylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 28980406 |
| Molecular Formula | C22H23N3OS |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | 5-[(2R)-1-[(2-methylphenyl)methyl]pyrrolidin-2-yl]-N-pyridin-4-ylthiophene-2-carboxamide |
| SMILES | Cc1ccccc1CN1CCC[C@@H]1c1ccc(C(=O)Nc2ccncc2)s1 |
| InChI | InChI=1S/C22H23N3OS/c1-16-5-2-3-6-17(16)15-25-14-4-7-19(25)20-8-9-21(27-20)22(26)24-18-10-12-23-13-11-18/h2-3,5-6,8-13,19H,4,7,14-15H2,1H3,(H,23,24,26)/t19-/m1/s1 |
| InChIKey | IBGBEJNBYOCNGS-LJQANCHMSA-N |
| XLogP | 5.04 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |