C19H24N2 — CID 112826237
1-[(2-methylphenyl)methyl]-2-pyridin-4-ylazepane (PubChem CID 112826237) has the molecular formula C19H24N2 and a molecular weight of 280.42 g/mol. Its IUPAC name is 1-[(2-methylphenyl)methyl]-2-pyridin-4-ylazepane.
| Compound Name | 1-[(2-methylphenyl)methyl]-2-pyridin-4-ylazepane |
|---|---|
| PubChem CID | 112826237 |
| Molecular Formula | C19H24N2 |
| Molecular Weight | 280.42 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | 1-[(2-methylphenyl)methyl]-2-pyridin-4-ylazepane |
| SMILES | Cc1ccccc1CN1CCCCCC1c1ccncc1 |
| InChI | InChI=1S/C19H24N2/c1-16-7-4-5-8-18(16)15-21-14-6-2-3-9-19(21)17-10-12-20-13-11-17/h4-5,7-8,10-13,19H,2-3,6,9,14-15H2,1H3 |
| InChIKey | UUFSJRZUIAISSE-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.42 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |