C20H27N3O2S — CID 45197540
N-(3,5-dimethyl-1,2-oxazol-4-yl)-5-[1-[(E)-hex-2-enyl]pyrrolidin-2-yl]thiophene-2-carboxamide (PubChem CID 45197540) has the molecular formula C20H27N3O2S and a molecular weight of 373.52 g/mol. Its IUPAC name is N-(3,5-dimethyl-1,2-oxazol-4-yl)-5-[1-[(E)-hex-2-enyl]pyrrolidin-2-yl]thiophene-2-carboxamide.
| Compound Name | N-(3,5-dimethyl-1,2-oxazol-4-yl)-5-[1-[(E)-hex-2-enyl]pyrrolidin-2-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 45197540 |
| Molecular Formula | C20H27N3O2S |
| Molecular Weight | 373.52 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | N-(3,5-dimethyl-1,2-oxazol-4-yl)-5-[1-[(E)-hex-2-enyl]pyrrolidin-2-yl]thiophene-2-carboxamide |
| SMILES | CCC/C=C/CN1CCCC1c1ccc(C(=O)Nc2c(C)noc2C)s1 |
| InChI | InChI=1S/C20H27N3O2S/c1-4-5-6-7-12-23-13-8-9-16(23)17-10-11-18(26-17)20(24)21-19-14(2)22-25-15(19)3/h6-7,10-11,16H,4-5,8-9,12-13H2,1-3H3,(H,21,24)/b7-6+ |
| InChIKey | MZCFZWOZKRWDAK-VOTSOKGWSA-N |
| XLogP | 5.10 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.52 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|