C12H16N4S — CID 124641351
2-[[(2R)-2-(1H-pyrazol-5-yl)piperidin-1-yl]methyl]-1,3-thiazole (PubChem CID 124641351) has the molecular formula C12H16N4S and a molecular weight of 248.35 g/mol. Its IUPAC name is 2-[[(2R)-2-(1H-pyrazol-5-yl)piperidin-1-yl]methyl]-1,3-thiazole.
| Compound Name | 2-[[(2R)-2-(1H-pyrazol-5-yl)piperidin-1-yl]methyl]-1,3-thiazole |
|---|---|
| PubChem CID | 124641351 |
| Molecular Formula | C12H16N4S |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | 2-[[(2R)-2-(1H-pyrazol-5-yl)piperidin-1-yl]methyl]-1,3-thiazole |
| SMILES | c1cc([C@H]2CCCCN2Cc2nccs2)[nH]n1 |
| InChI | InChI=1S/C12H16N4S/c1-2-7-16(9-12-13-6-8-17-12)11(3-1)10-4-5-14-15-10/h4-6,8,11H,1-3,7,9H2,(H,14,15)/t11-/m1/s1 |
| InChIKey | MAUYNLKXVXBPSM-LLVKDONJSA-N |
| XLogP | 2.59 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |