C18H29NO3S — CID 86779105
2-(4-methoxyphenyl)-1-(4-methylsulfonylbutyl)azepane (PubChem CID 86779105) has the molecular formula C18H29NO3S and a molecular weight of 339.50 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-1-(4-methylsulfonylbutyl)azepane.
| Compound Name | 2-(4-methoxyphenyl)-1-(4-methylsulfonylbutyl)azepane |
|---|---|
| PubChem CID | 86779105 |
| Molecular Formula | C18H29NO3S |
| Molecular Weight | 339.50 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | 2-(4-methoxyphenyl)-1-(4-methylsulfonylbutyl)azepane |
| SMILES | COc1ccc(C2CCCCCN2CCCCS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C18H29NO3S/c1-22-17-11-9-16(10-12-17)18-8-4-3-5-13-19(18)14-6-7-15-23(2,20)21/h9-12,18H,3-8,13-15H2,1-2H3 |
| InChIKey | PTXGVCFALCIYQC-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.50 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|