C22H30N4O5S — CID 34610722
N-[2-[4-[(3-morpholin-4-ylsulfonylphenyl)methyl]piperazin-1-yl]ethyl]furan-2-carboxamide (PubChem CID 34610722) has the molecular formula C22H30N4O5S and a molecular weight of 462.57 g/mol. Its IUPAC name is N-[2-[4-[(3-morpholin-4-ylsulfonylphenyl)methyl]piperazin-1-yl]ethyl]furan-2-carboxamide.
| Compound Name | N-[2-[4-[(3-morpholin-4-ylsulfonylphenyl)methyl]piperazin-1-yl]ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 34610722 |
| Molecular Formula | C22H30N4O5S |
| Molecular Weight | 462.57 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | N-[2-[4-[(3-morpholin-4-ylsulfonylphenyl)methyl]piperazin-1-yl]ethyl]furan-2-carboxamide |
| SMILES | O=C(NCCN1CCN(Cc2cccc(S(=O)(=O)N3CCOCC3)c2)CC1)c1ccco1 |
| InChI | InChI=1S/C22H30N4O5S/c27-22(21-5-2-14-31-21)23-6-7-24-8-10-25(11-9-24)18-19-3-1-4-20(17-19)32(28,29)26-12-15-30-16-13-26/h1-5,14,17H,6-13,15-16,18H2,(H,23,27) |
| InChIKey | TZBFTWUNXAPCQN-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 95.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.57 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |