C26H34N2O4S — CID 55689992
N-[cyclohexyl(phenyl)methyl]-3-(4-morpholin-4-ylsulfonylphenyl)propanamide (PubChem CID 55689992) has the molecular formula C26H34N2O4S and a molecular weight of 470.64 g/mol. Its IUPAC name is N-[cyclohexyl(phenyl)methyl]-3-(4-morpholin-4-ylsulfonylphenyl)propanamide.
| Compound Name | N-[cyclohexyl(phenyl)methyl]-3-(4-morpholin-4-ylsulfonylphenyl)propanamide |
|---|---|
| PubChem CID | 55689992 |
| Molecular Formula | C26H34N2O4S |
| Molecular Weight | 470.64 g/mol |
| Exact Mass | 470.22 |
| IUPAC Name | N-[cyclohexyl(phenyl)methyl]-3-(4-morpholin-4-ylsulfonylphenyl)propanamide |
| SMILES | O=C(CCc1ccc(S(=O)(=O)N2CCOCC2)cc1)NC(c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C26H34N2O4S/c29-25(27-26(22-7-3-1-4-8-22)23-9-5-2-6-10-23)16-13-21-11-14-24(15-12-21)33(30,31)28-17-19-32-20-18-28/h1,3-4,7-8,11-12,14-15,23,26H,2,5-6,9-10,13,16-20H2,(H,27,29) |
| InChIKey | FXCSWMFCASRPQQ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.64 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |