C22H28N2O4S2 — CID 28557563
N-[(1R)-1-(4-methylsulfanylphenyl)ethyl]-3-(4-morpholin-4-ylsulfonylphenyl)propanamide (PubChem CID 28557563) has the molecular formula C22H28N2O4S2 and a molecular weight of 448.61 g/mol. Its IUPAC name is N-[(1R)-1-(4-methylsulfanylphenyl)ethyl]-3-(4-morpholin-4-ylsulfonylphenyl)propanamide.
| Compound Name | N-[(1R)-1-(4-methylsulfanylphenyl)ethyl]-3-(4-morpholin-4-ylsulfonylphenyl)propanamide |
|---|---|
| PubChem CID | 28557563 |
| Molecular Formula | C22H28N2O4S2 |
| Molecular Weight | 448.61 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | N-[(1R)-1-(4-methylsulfanylphenyl)ethyl]-3-(4-morpholin-4-ylsulfonylphenyl)propanamide |
| SMILES | CSc1ccc([C@@H](C)NC(=O)CCc2ccc(S(=O)(=O)N3CCOCC3)cc2)cc1 |
| InChI | InChI=1S/C22H28N2O4S2/c1-17(19-6-8-20(29-2)9-7-19)23-22(25)12-5-18-3-10-21(11-4-18)30(26,27)24-13-15-28-16-14-24/h3-4,6-11,17H,5,12-16H2,1-2H3,(H,23,25)/t17-/m1/s1 |
| InChIKey | DXNSENNIEPAEGT-QGZVFWFLSA-N |
| XLogP | 3.24 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.61 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |