C19H24N2O3S2 — CID 43873885
3-[4-(methylsulfamoyl)phenyl]-N-[1-(4-methylsulfanylphenyl)ethyl]propanamide (PubChem CID 43873885) has the molecular formula C19H24N2O3S2 and a molecular weight of 392.55 g/mol. Its IUPAC name is 3-[4-(methylsulfamoyl)phenyl]-N-[1-(4-methylsulfanylphenyl)ethyl]propanamide.
| Compound Name | 3-[4-(methylsulfamoyl)phenyl]-N-[1-(4-methylsulfanylphenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 43873885 |
| Molecular Formula | C19H24N2O3S2 |
| Molecular Weight | 392.55 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | 3-[4-(methylsulfamoyl)phenyl]-N-[1-(4-methylsulfanylphenyl)ethyl]propanamide |
| SMILES | CNS(=O)(=O)c1ccc(CCC(=O)NC(C)c2ccc(SC)cc2)cc1 |
| InChI | InChI=1S/C19H24N2O3S2/c1-14(16-7-9-17(25-3)10-8-16)21-19(22)13-6-15-4-11-18(12-5-15)26(23,24)20-2/h4-5,7-12,14,20H,6,13H2,1-3H3,(H,21,22) |
| InChIKey | VRWILOPMAZSVMT-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.55 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |