C15H22N2O5S — CID 119169867
3-methyl-2-[3-[4-(methylsulfamoyl)phenyl]propanoylamino]butanoic acid (PubChem CID 119169867) has the molecular formula C15H22N2O5S and a molecular weight of 342.42 g/mol. Its IUPAC name is 3-methyl-2-[3-[4-(methylsulfamoyl)phenyl]propanoylamino]butanoic acid.
| Compound Name | 3-methyl-2-[3-[4-(methylsulfamoyl)phenyl]propanoylamino]butanoic acid |
|---|---|
| PubChem CID | 119169867 |
| Molecular Formula | C15H22N2O5S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | 3-methyl-2-[3-[4-(methylsulfamoyl)phenyl]propanoylamino]butanoic acid |
| SMILES | CNS(=O)(=O)c1ccc(CCC(=O)NC(C(=O)O)C(C)C)cc1 |
| InChI | InChI=1S/C15H22N2O5S/c1-10(2)14(15(19)20)17-13(18)9-6-11-4-7-12(8-5-11)23(21,22)16-3/h4-5,7-8,10,14,16H,6,9H2,1-3H3,(H,17,18)(H,19,20) |
| InChIKey | YLDDTSGULBQXQC-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |