C16H24N2O5S — CID 119193799
(2S,3S)-3-methyl-2-[3-[4-(methylsulfamoyl)phenyl]propanoylamino]pentanoic acid (PubChem CID 119193799) has the molecular formula C16H24N2O5S and a molecular weight of 356.44 g/mol. Its IUPAC name is (2S,3S)-3-methyl-2-[3-[4-(methylsulfamoyl)phenyl]propanoylamino]pentanoic acid.
| Compound Name | (2S,3S)-3-methyl-2-[3-[4-(methylsulfamoyl)phenyl]propanoylamino]pentanoic acid |
|---|---|
| PubChem CID | 119193799 |
| Molecular Formula | C16H24N2O5S |
| Molecular Weight | 356.44 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | (2S,3S)-3-methyl-2-[3-[4-(methylsulfamoyl)phenyl]propanoylamino]pentanoic acid |
| SMILES | CC[C@H](C)[C@H](NC(=O)CCc1ccc(S(=O)(=O)NC)cc1)C(=O)O |
| InChI | InChI=1S/C16H24N2O5S/c1-4-11(2)15(16(20)21)18-14(19)10-7-12-5-8-13(9-6-12)24(22,23)17-3/h5-6,8-9,11,15,17H,4,7,10H2,1-3H3,(H,18,19)(H,20,21)/t11-,15-/m0/s1 |
| InChIKey | JUHXMMSWJGLPKM-NHYWBVRUSA-N |
| XLogP | 1.14 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.44 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |