C22H28N2O3S2 — CID 28557494
N-[(1R)-1-(4-methylsulfanylphenyl)ethyl]-3-(4-pyrrolidin-1-ylsulfonylphenyl)propanamide (PubChem CID 28557494) has the molecular formula C22H28N2O3S2 and a molecular weight of 432.61 g/mol. Its IUPAC name is N-[(1R)-1-(4-methylsulfanylphenyl)ethyl]-3-(4-pyrrolidin-1-ylsulfonylphenyl)propanamide.
| Compound Name | N-[(1R)-1-(4-methylsulfanylphenyl)ethyl]-3-(4-pyrrolidin-1-ylsulfonylphenyl)propanamide |
|---|---|
| PubChem CID | 28557494 |
| Molecular Formula | C22H28N2O3S2 |
| Molecular Weight | 432.61 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | N-[(1R)-1-(4-methylsulfanylphenyl)ethyl]-3-(4-pyrrolidin-1-ylsulfonylphenyl)propanamide |
| SMILES | CSc1ccc([C@@H](C)NC(=O)CCc2ccc(S(=O)(=O)N3CCCC3)cc2)cc1 |
| InChI | InChI=1S/C22H28N2O3S2/c1-17(19-8-10-20(28-2)11-9-19)23-22(25)14-7-18-5-12-21(13-6-18)29(26,27)24-15-3-4-16-24/h5-6,8-13,17H,3-4,7,14-16H2,1-2H3,(H,23,25)/t17-/m1/s1 |
| InChIKey | SGCJAZKAFGSSEA-QGZVFWFLSA-N |
| XLogP | 4.00 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.61 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |