C23H27N5O3S — CID 55857423
N-(1-benzyl-1,2,4-triazol-3-yl)-3-[cyclohexyl(methyl)sulfamoyl]benzamide (PubChem CID 55857423) has the molecular formula C23H27N5O3S and a molecular weight of 453.57 g/mol. Its IUPAC name is N-(1-benzyl-1,2,4-triazol-3-yl)-3-[cyclohexyl(methyl)sulfamoyl]benzamide.
| Compound Name | N-(1-benzyl-1,2,4-triazol-3-yl)-3-[cyclohexyl(methyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 55857423 |
| Molecular Formula | C23H27N5O3S |
| Molecular Weight | 453.57 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | N-(1-benzyl-1,2,4-triazol-3-yl)-3-[cyclohexyl(methyl)sulfamoyl]benzamide |
| SMILES | CN(C1CCCCC1)S(=O)(=O)c1cccc(C(=O)Nc2ncn(Cc3ccccc3)n2)c1 |
| InChI | InChI=1S/C23H27N5O3S/c1-27(20-12-6-3-7-13-20)32(30,31)21-14-8-11-19(15-21)22(29)25-23-24-17-28(26-23)16-18-9-4-2-5-10-18/h2,4-5,8-11,14-15,17,20H,3,6-7,12-13,16H2,1H3,(H,25,26,29) |
| InChIKey | CMENDDREWMYPJF-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.57 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |