C19H25ClN4O3S — CID 119515813
N-(6-amino-3-pyridinyl)-3-[cyclohexyl(methyl)sulfamoyl]benzamide;hydrochloride (PubChem CID 119515813) has the molecular formula C19H25ClN4O3S and a molecular weight of 424.95 g/mol. Its IUPAC name is N-(6-amino-3-pyridinyl)-3-[cyclohexyl(methyl)sulfamoyl]benzamide;hydrochloride.
| Compound Name | N-(6-amino-3-pyridinyl)-3-[cyclohexyl(methyl)sulfamoyl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 119515813 |
| Molecular Formula | C19H25ClN4O3S |
| Molecular Weight | 424.95 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | N-(6-amino-3-pyridinyl)-3-[cyclohexyl(methyl)sulfamoyl]benzamide;hydrochloride |
| SMILES | CN(C1CCCCC1)S(=O)(=O)c1cccc(C(=O)Nc2ccc(N)nc2)c1.Cl |
| InChI | InChI=1S/C19H24N4O3S.ClH/c1-23(16-7-3-2-4-8-16)27(25,26)17-9-5-6-14(12-17)19(24)22-15-10-11-18(20)21-13-15;/h5-6,9-13,16H,2-4,7-8H2,1H3,(H2,20,21)(H,22,24);1H |
| InChIKey | XOTFFTWEVXOZNF-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 105.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.95 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |